C25H16F23N — CID 87992723
1,1,2,2,3,3-hexafluoro-N-(fluoromethyl)nonan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene (PubChem CID 87992723) has the molecular formula C25H16F23N and a molecular weight of 767.36 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-N-(fluoromethyl)nonan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,1,2,2,3,3-hexafluoro-N-(fluoromethyl)nonan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 87992723 |
| Molecular Formula | C25H16F23N |
| Molecular Weight | 767.36 g/mol |
| Exact Mass | 767.09 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-N-(fluoromethyl)nonan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)NCF.Fc1c(F)c(F)c(-c2c(C(F)(F)F)c(F)c(F)c(F)c2C(F)(F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C15F16.C10H16F7N/c16-5-2(6(17)10(21)12(23)9(5)20)1-3(13(24,25)15(29,30)31)7(18)11(22)8(19)4(1)14(26,27)28;1-2-3-4-5-6-8(12,13)9(14,15)10(16,17)18-7-11/h;18H,2-7H2,1H3 |
| InChIKey | JBFCHFGGEBOEQM-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.36 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|