C17H13F16P — CID 22637718
1,1,2,2,3,3-hexafluorononyl-(1,1,2,2,2-pentafluoroethyl)-(2,3,4,5,6-pentafluorophenyl)phosphane (PubChem CID 22637718) has the molecular formula C17H13F16P and a molecular weight of 552.23 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluorononyl-(1,1,2,2,2-pentafluoroethyl)-(2,3,4,5,6-pentafluorophenyl)phosphane.
| Compound Name | 1,1,2,2,3,3-hexafluorononyl-(1,1,2,2,2-pentafluoroethyl)-(2,3,4,5,6-pentafluorophenyl)phosphane |
|---|---|
| PubChem CID | 22637718 |
| Molecular Formula | C17H13F16P |
| Molecular Weight | 552.23 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | 1,1,2,2,3,3-hexafluorononyl-(1,1,2,2,2-pentafluoroethyl)-(2,3,4,5,6-pentafluorophenyl)phosphane |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)P(c1c(F)c(F)c(F)c(F)c1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H13F16P/c1-2-3-4-5-6-13(23,24)14(25,26)16(30,31)34(17(32,33)15(27,28)29)12-10(21)8(19)7(18)9(20)11(12)22/h2-6H2,1H3 |
| InChIKey | OXTVBXXZLHWWJS-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.23 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|