C69H130BF8P — CID 22637794
(5-ethyl-2-methyloctyl)-hexyl-[2,4,5-trifluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]phosphanium;tetrakis(5-ethyl-2-methyloctyl)boranuide (PubChem CID 22637794) has the molecular formula C69H130BF8P and a molecular weight of 1153.57 g/mol. Its IUPAC name is (5-ethyl-2-methyloctyl)-hexyl-[2,4,5-trifluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]phosphanium;tetrakis(5-ethyl-2-methyloctyl)boranuide.
| Compound Name | (5-ethyl-2-methyloctyl)-hexyl-[2,4,5-trifluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]phosphanium;tetrakis(5-ethyl-2-methyloctyl)boranuide |
|---|---|
| PubChem CID | 22637794 |
| Molecular Formula | C69H130BF8P |
| Molecular Weight | 1153.57 g/mol |
| Exact Mass | 1152.99 |
| IUPAC Name | (5-ethyl-2-methyloctyl)-hexyl-[2,4,5-trifluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]phosphanium;tetrakis(5-ethyl-2-methyloctyl)boranuide |
| SMILES | CCCC(CC)CCC(C)C[B-](CC(C)CCC(CC)CCC)(CC(C)CCC(CC)CCC)CC(C)CCC(CC)CCC.CCCCCC[PH+](CC(C)CCC(CC)CCC)c1cc(F)c(F)c(C(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C44H92B.C25H37F8P/c1-13-21-41(17-5)29-25-37(9)33-45(34-38(10)26-30-42(18-6)22-14-2,35-39(11)27-31-43(19-7)23-15-3)36-40(12)28-32-44(20-8)24-16-4;1-5-8-9-10-14-34(16-17(4)12-13-18(7-3)11-6-2)20-15-19(26)22(27)21(23(20)28)24(29,30)25(31,32)33/h37-44H,13-36H2,1-12H3;15,17-18H,5-14,16H2,1-4H3/q-1;/p+1 |
| InChIKey | RXSGWYYWSNPUIU-UHFFFAOYSA-O |
| XLogP | 25.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 47 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1153.57 |
| LogP ≤ 5 | 25.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|