C12H16F4P+ — CID 23123044
butyl-ethyl-(2,3,4,5-tetrafluorophenyl)phosphanium (PubChem CID 23123044) has the molecular formula C12H16F4P+ and a molecular weight of 267.23 g/mol. Its IUPAC name is butyl-ethyl-(2,3,4,5-tetrafluorophenyl)phosphanium.
| Compound Name | butyl-ethyl-(2,3,4,5-tetrafluorophenyl)phosphanium |
|---|---|
| PubChem CID | 23123044 |
| Molecular Formula | C12H16F4P+ |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | butyl-ethyl-(2,3,4,5-tetrafluorophenyl)phosphanium |
| SMILES | CCCC[PH+](CC)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H15F4P/c1-3-5-6-17(4-2)9-7-8(13)10(14)12(16)11(9)15/h7H,3-6H2,1-2H3/p+1 |
| InChIKey | UPFHMCGIYJKBDN-UHFFFAOYSA-O |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|