C43H82BF4P — CID 22637807
butyl-nonyl-(2,3,4,5-tetrafluorophenyl)phosphanium;tetrakis(2-methylpentyl)boranuide (PubChem CID 22637807) has the molecular formula C43H82BF4P and a molecular weight of 716.91 g/mol. Its IUPAC name is butyl-nonyl-(2,3,4,5-tetrafluorophenyl)phosphanium;tetrakis(2-methylpentyl)boranuide.
| Compound Name | butyl-nonyl-(2,3,4,5-tetrafluorophenyl)phosphanium;tetrakis(2-methylpentyl)boranuide |
|---|---|
| PubChem CID | 22637807 |
| Molecular Formula | C43H82BF4P |
| Molecular Weight | 716.91 g/mol |
| Exact Mass | 716.62 |
| IUPAC Name | butyl-nonyl-(2,3,4,5-tetrafluorophenyl)phosphanium;tetrakis(2-methylpentyl)boranuide |
| SMILES | CCCC(C)C[B-](CC(C)CCC)(CC(C)CCC)CC(C)CCC.CCCCCCCCC[PH+](CCCC)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H52B.C19H29F4P/c1-9-13-21(5)17-25(18-22(6)14-10-2,19-23(7)15-11-3)20-24(8)16-12-4;1-3-5-7-8-9-10-11-13-24(12-6-4-2)16-14-15(20)17(21)19(23)18(16)22/h21-24H,9-20H2,1-8H3;14H,3-13H2,1-2H3/q-1;/p+1 |
| InChIKey | GBZDLJSWCJVHBS-UHFFFAOYSA-O |
| XLogP | 15.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.91 |
| LogP ≤ 5 | 15.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|