C18H18F8 — CID 174662628
2-methylheptane;1,2,3,4,5,6,7,8-octafluoronaphthalene (PubChem CID 174662628) has the molecular formula C18H18F8 and a molecular weight of 386.33 g/mol. Its IUPAC name is 2-methylheptane;1,2,3,4,5,6,7,8-octafluoronaphthalene.
| Compound Name | 2-methylheptane;1,2,3,4,5,6,7,8-octafluoronaphthalene |
|---|---|
| PubChem CID | 174662628 |
| Molecular Formula | C18H18F8 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-methylheptane;1,2,3,4,5,6,7,8-octafluoronaphthalene |
| SMILES | CCCCCC(C)C.Fc1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C10F8.C8H18/c11-3-1-2(5(13)9(17)7(3)15)6(14)10(18)8(16)4(1)12;1-4-5-6-7-8(2)3/h;8H,4-7H2,1-3H3 |
| InChIKey | WUJJJHRSRQEHJQ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|