C18H25F6N — CID 22638067
N-(5-ethyl-2-methyloctyl)-2,3,4,5,6-pentafluoro-N-(fluoromethyl)aniline (PubChem CID 22638067) has the molecular formula C18H25F6N and a molecular weight of 369.39 g/mol. Its IUPAC name is N-(5-ethyl-2-methyloctyl)-2,3,4,5,6-pentafluoro-N-(fluoromethyl)aniline.
| Compound Name | N-(5-ethyl-2-methyloctyl)-2,3,4,5,6-pentafluoro-N-(fluoromethyl)aniline |
|---|---|
| PubChem CID | 22638067 |
| Molecular Formula | C18H25F6N |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-(5-ethyl-2-methyloctyl)-2,3,4,5,6-pentafluoro-N-(fluoromethyl)aniline |
| SMILES | CCCC(CC)CCC(C)CN(CF)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H25F6N/c1-4-6-12(5-2)8-7-11(3)9-25(10-19)18-16(23)14(21)13(20)15(22)17(18)24/h11-12H,4-10H2,1-3H3 |
| InChIKey | HLQFLNMRXJPTMJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|