C40H71AlF9N — CID 18388725
(2,5-difluorophenyl)-(fluoromethyl)-(1,1,2,2,3,3-hexafluorononyl)azanium;tetrakis(2-methylpentyl)alumanuide (PubChem CID 18388725) has the molecular formula C40H71AlF9N and a molecular weight of 763.98 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(fluoromethyl)-(1,1,2,2,3,3-hexafluorononyl)azanium;tetrakis(2-methylpentyl)alumanuide.
| Compound Name | (2,5-difluorophenyl)-(fluoromethyl)-(1,1,2,2,3,3-hexafluorononyl)azanium;tetrakis(2-methylpentyl)alumanuide |
|---|---|
| PubChem CID | 18388725 |
| Molecular Formula | C40H71AlF9N |
| Molecular Weight | 763.98 g/mol |
| Exact Mass | 763.53 |
| IUPAC Name | (2,5-difluorophenyl)-(fluoromethyl)-(1,1,2,2,3,3-hexafluorononyl)azanium;tetrakis(2-methylpentyl)alumanuide |
| SMILES | CCCC(C)C[Al-](CC(C)CCC)(CC(C)CCC)CC(C)CCC.CCCCCCC(F)(F)C(F)(F)C(F)(F)[NH+](CF)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H18F9N.4C6H13.Al/c1-2-3-4-5-8-14(20,21)15(22,23)16(24,25)26(10-17)13-9-11(18)6-7-12(13)19;4*1-4-5-6(2)3;/h6-7,9H,2-5,8,10H2,1H3;4*6H,2,4-5H2,1,3H3;/q;;;;;-1/p+1 |
| InChIKey | UWLCDLDMGBXZKL-UHFFFAOYSA-O |
| XLogP | 14.42 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 26 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.98 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|