C11H11F7N+ — CID 23123171
(2,5-difluorophenyl)-(1,1,2,2,2-pentafluoroethyl)-propylazanium (PubChem CID 23123171) has the molecular formula C11H11F7N+ and a molecular weight of 290.20 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(1,1,2,2,2-pentafluoroethyl)-propylazanium.
| Compound Name | (2,5-difluorophenyl)-(1,1,2,2,2-pentafluoroethyl)-propylazanium |
|---|---|
| PubChem CID | 23123171 |
| Molecular Formula | C11H11F7N+ |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (2,5-difluorophenyl)-(1,1,2,2,2-pentafluoroethyl)-propylazanium |
| SMILES | CCC[NH+](c1cc(F)ccc1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F7N/c1-2-5-19(11(17,18)10(14,15)16)9-6-7(12)3-4-8(9)13/h3-4,6H,2,5H2,1H3/p+1 |
| InChIKey | CKVYEKOEDWDKMW-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|