C47H63BF31N — CID 22638120
(2,5-difluorophenyl)-(1,1,2,2,2-pentafluoroethyl)-propylazanium;tetrakis(1,1,2,2,3,3-hexafluorononyl)boranuide (PubChem CID 22638120) has the molecular formula C47H63BF31N and a molecular weight of 1241.78 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(1,1,2,2,2-pentafluoroethyl)-propylazanium;tetrakis(1,1,2,2,3,3-hexafluorononyl)boranuide.
| Compound Name | (2,5-difluorophenyl)-(1,1,2,2,2-pentafluoroethyl)-propylazanium;tetrakis(1,1,2,2,3,3-hexafluorononyl)boranuide |
|---|---|
| PubChem CID | 22638120 |
| Molecular Formula | C47H63BF31N |
| Molecular Weight | 1241.78 g/mol |
| Exact Mass | 1241.46 |
| IUPAC Name | (2,5-difluorophenyl)-(1,1,2,2,2-pentafluoroethyl)-propylazanium;tetrakis(1,1,2,2,3,3-hexafluorononyl)boranuide |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)[B-](C(F)(F)C(F)(F)C(F)(F)CCCCCC)(C(F)(F)C(F)(F)C(F)(F)CCCCCC)C(F)(F)C(F)(F)C(F)(F)CCCCCC.CCC[NH+](c1cc(F)ccc1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C36H52BF24.C11H10F7N/c1-5-9-13-17-21-25(38,39)29(46,47)33(54,55)37(34(56,57)30(48,49)26(40,41)22-18-14-10-6-2,35(58,59)31(50,51)27(42,43)23-19-15-11-7-3)36(60,61)32(52,53)28(44,45)24-20-16-12-8-4;1-2-5-19(11(17,18)10(14,15)16)9-6-7(12)3-4-8(9)13/h5-24H2,1-4H3;3-4,6H,2,5H2,1H3/q-1;/p+1 |
| InChIKey | OTFVZWNEODBOTC-UHFFFAOYSA-O |
| XLogP | 20.14 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 36 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1241.78 |
| LogP ≤ 5 | 20.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|