C11H16F2N+ — CID 173158771
(2,5-difluorophenyl)-dimethyl-propylazanium (PubChem CID 173158771) has the molecular formula C11H16F2N+ and a molecular weight of 200.25 g/mol. Its IUPAC name is (2,5-difluorophenyl)-dimethyl-propylazanium.
| Compound Name | (2,5-difluorophenyl)-dimethyl-propylazanium |
|---|---|
| PubChem CID | 173158771 |
| Molecular Formula | C11H16F2N+ |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2,5-difluorophenyl)-dimethyl-propylazanium |
| SMILES | CCC[N+](C)(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H16F2N/c1-4-7-14(2,3)11-8-9(12)5-6-10(11)13/h5-6,8H,4,7H2,1-3H3/q+1 |
| InChIKey | NVFLWHJLPLKWTA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|