C12H15F2N2O3+ — CID 23039295
(2-aminoacetyl)-(2,5-difluorophenyl)-ethoxycarbonyl-methylazanium (PubChem CID 23039295) has the molecular formula C12H15F2N2O3+ and a molecular weight of 273.26 g/mol. Its IUPAC name is (2-aminoacetyl)-(2,5-difluorophenyl)-ethoxycarbonyl-methylazanium.
| Compound Name | (2-aminoacetyl)-(2,5-difluorophenyl)-ethoxycarbonyl-methylazanium |
|---|---|
| PubChem CID | 23039295 |
| Molecular Formula | C12H15F2N2O3+ |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2-aminoacetyl)-(2,5-difluorophenyl)-ethoxycarbonyl-methylazanium |
| SMILES | CCOC(=O)[N+](C)(C(=O)CN)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H15F2N2O3/c1-3-19-12(18)16(2,11(17)7-15)10-6-8(13)4-5-9(10)14/h4-6H,3,7,15H2,1-2H3/q+1 |
| InChIKey | AHORGONMEQNQII-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|