C11H12F2O3 — CID 63268646
ethyl 3-(2,5-difluorophenoxy)propanoate (PubChem CID 63268646) has the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. Its IUPAC name is ethyl 3-(2,5-difluorophenoxy)propanoate.
| Compound Name | ethyl 3-(2,5-difluorophenoxy)propanoate |
|---|---|
| PubChem CID | 63268646 |
| Molecular Formula | C11H12F2O3 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | ethyl 3-(2,5-difluorophenoxy)propanoate |
| SMILES | CCOC(=O)CCOc1cc(F)ccc1F |
| InChI | InChI=1S/C11H12F2O3/c1-2-15-11(14)5-6-16-10-7-8(12)3-4-9(10)13/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | FIJCBRXCQGSRAJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |