C9H10F2N2O2 — CID 76992494
3-(2,5-difluorophenoxy)-N'-hydroxypropanimidamide (PubChem CID 76992494) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is 3-(2,5-difluorophenoxy)-N'-hydroxypropanimidamide.
| Compound Name | 3-(2,5-difluorophenoxy)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 76992494 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-(2,5-difluorophenoxy)-N'-hydroxypropanimidamide |
| SMILES | NC(CCOc1cc(F)ccc1F)=NO |
| InChI | InChI=1S/C9H10F2N2O2/c10-6-1-2-7(11)8(5-6)15-4-3-9(12)13-14/h1-2,5,14H,3-4H2,(H2,12,13) |
| InChIKey | LUWXQDOSDXDBPE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|