C10H13F3N+ — CID 23123513
(2,4-difluorophenyl)-(fluoromethyl)-propylazanium (PubChem CID 23123513) has the molecular formula C10H13F3N+ and a molecular weight of 204.22 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(fluoromethyl)-propylazanium.
| Compound Name | (2,4-difluorophenyl)-(fluoromethyl)-propylazanium |
|---|---|
| PubChem CID | 23123513 |
| Molecular Formula | C10H13F3N+ |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (2,4-difluorophenyl)-(fluoromethyl)-propylazanium |
| SMILES | CCC[NH+](CF)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H12F3N/c1-2-5-14(7-11)10-4-3-8(12)6-9(10)13/h3-4,6H,2,5,7H2,1H3/p+1 |
| InChIKey | SETFQKOVQWCKPY-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|