C9H11F3N+ — CID 23123674
(2,4-difluorophenyl)-ethyl-(fluoromethyl)azanium (PubChem CID 23123674) has the molecular formula C9H11F3N+ and a molecular weight of 190.19 g/mol. Its IUPAC name is (2,4-difluorophenyl)-ethyl-(fluoromethyl)azanium.
| Compound Name | (2,4-difluorophenyl)-ethyl-(fluoromethyl)azanium |
|---|---|
| PubChem CID | 23123674 |
| Molecular Formula | C9H11F3N+ |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (2,4-difluorophenyl)-ethyl-(fluoromethyl)azanium |
| SMILES | CC[NH+](CF)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H10F3N/c1-2-13(6-10)9-4-3-7(11)5-8(9)12/h3-5H,2,6H2,1H3/p+1 |
| InChIKey | BYPGRBQESIZVMY-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|