C9H10F2S — CID 91657273
1-(ethylsulfanylmethyl)-2,4-difluorobenzene (PubChem CID 91657273) has the molecular formula C9H10F2S and a molecular weight of 188.24 g/mol. Its IUPAC name is 1-(ethylsulfanylmethyl)-2,4-difluorobenzene.
| Compound Name | 1-(ethylsulfanylmethyl)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 91657273 |
| Molecular Formula | C9H10F2S |
| Molecular Weight | 188.24 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 1-(ethylsulfanylmethyl)-2,4-difluorobenzene |
| SMILES | CCSCc1ccc(F)cc1F |
| InChI | InChI=1S/C9H10F2S/c1-2-12-6-7-3-4-8(10)5-9(7)11/h3-5H,2,6H2,1H3 |
| InChIKey | JMQMTCBGICCYPK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |