C63H24BF30N — CID 22637736
(2,4-difluorophenyl)-ethyl-propylazanium;tetrakis(1,2,3,4,5,6,7-heptafluoro-9H-fluoren-9-yl)boranuide (PubChem CID 22637736) has the molecular formula C63H24BF30N and a molecular weight of 1375.64 g/mol. Its IUPAC name is (2,4-difluorophenyl)-ethyl-propylazanium;tetrakis(1,2,3,4,5,6,7-heptafluoro-9H-fluoren-9-yl)boranuide.
| Compound Name | (2,4-difluorophenyl)-ethyl-propylazanium;tetrakis(1,2,3,4,5,6,7-heptafluoro-9H-fluoren-9-yl)boranuide |
|---|---|
| PubChem CID | 22637736 |
| Molecular Formula | C63H24BF30N |
| Molecular Weight | 1375.64 g/mol |
| Exact Mass | 1375.15 |
| IUPAC Name | (2,4-difluorophenyl)-ethyl-propylazanium;tetrakis(1,2,3,4,5,6,7-heptafluoro-9H-fluoren-9-yl)boranuide |
| SMILES | CCC[NH+](CC)c1ccc(F)cc1F.Fc1cc2c(c(F)c1F)-c1c(F)c(F)c(F)c(F)c1C2[B-](C1c2cc(F)c(F)c(F)c2-c2c(F)c(F)c(F)c(F)c21)(C1c2cc(F)c(F)c(F)c2-c2c(F)c(F)c(F)c(F)c21)C1c2cc(F)c(F)c(F)c2-c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C52H8BF28.C11H15F2N/c54-9-1-5-13(33(62)29(9)58)17-21(41(70)49(78)45(74)37(17)66)25(5)53(26-6-2-10(55)30(59)34(63)14(6)18-22(26)42(71)50(79)46(75)38(18)67,27-7-3-11(56)31(60)35(64)15(7)19-23(27)43(72)51(80)47(76)39(19)68)28-8-4-12(57)32(61)36(65)16(8)20-24(28)44(73)52(81)48(77)40(20)69;1-3-7-14(4-2)11-6-5-9(12)8-10(11)13/h1-4,25-28H;5-6,8H,3-4,7H2,1-2H3/q-1;/p+1 |
| InChIKey | QZIULVAGOZPEAD-UHFFFAOYSA-O |
| XLogP | 18.65 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 95 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1375.64 |
| LogP ≤ 5 | 18.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|