C16H25F2P — CID 22925469
(2,4-difluorophenyl)-bis(2-methylbutan-2-yl)phosphane (PubChem CID 22925469) has the molecular formula C16H25F2P and a molecular weight of 286.35 g/mol. Its IUPAC name is (2,4-difluorophenyl)-bis(2-methylbutan-2-yl)phosphane.
| Compound Name | (2,4-difluorophenyl)-bis(2-methylbutan-2-yl)phosphane |
|---|---|
| PubChem CID | 22925469 |
| Molecular Formula | C16H25F2P |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (2,4-difluorophenyl)-bis(2-methylbutan-2-yl)phosphane |
| SMILES | CCC(C)(C)P(c1ccc(F)cc1F)C(C)(C)CC |
| InChI | InChI=1S/C16H25F2P/c1-7-15(3,4)19(16(5,6)8-2)14-10-9-12(17)11-13(14)18/h9-11H,7-8H2,1-6H3 |
| InChIKey | QANPROMSAUSODA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|