About dichloro-(2,4-difluorophenyl)phosphane
dichloro-(2,4-difluorophenyl)phosphane (PubChem CID 22925499) has the molecular formula C6H3Cl2F2P
and a molecular weight of 214.97 g/mol. Its IUPAC name is dichloro-(2,4-difluorophenyl)phosphane.
Molecular Properties
| Compound Name | dichloro-(2,4-difluorophenyl)phosphane |
| PubChem CID | 22925499 |
| Molecular Formula | C6H3Cl2F2P |
| Molecular Weight | 214.97 g/mol |
| Exact Mass | 213.93 |
| IUPAC Name | dichloro-(2,4-difluorophenyl)phosphane |
| SMILES | Fc1ccc(P(Cl)Cl)c(F)c1 |
| InChI | InChI=1S/C6H3Cl2F2P/c7-11(8)6-2-1-4(9)3-5(6)10/h1-3H |
| InChIKey | KXJFPVAGUPUGMO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.97 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro-(2,4-difluorophenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-(2,4-difluorophenyl)phosphane?
The IUPAC name of dichloro-(2,4-difluorophenyl)phosphane (CID 22925499) is dichloro-(2,4-difluorophenyl)phosphane.
What is the SMILES notation for dichloro-(2,4-difluorophenyl)phosphane?
The canonical SMILES for dichloro-(2,4-difluorophenyl)phosphane is Fc1ccc(P(Cl)Cl)c(F)c1.
What is the InChIKey of dichloro-(2,4-difluorophenyl)phosphane?
The InChIKey is KXJFPVAGUPUGMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2F2P/c7-11(8)6-2-1-4(9)3-5(6)10/h1-3H.
What are the key properties of dichloro-(2,4-difluorophenyl)phosphane?
dichloro-(2,4-difluorophenyl)phosphane has a molecular weight of 214.97 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-(2,4-difluorophenyl)phosphane is sourced from PubChem (CID 22925499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).