C7H9F2N — CID 155026278
2,4-difluoroaniline;methane (PubChem CID 155026278) has the molecular formula C7H9F2N and a molecular weight of 145.15 g/mol. Its IUPAC name is 2,4-difluoroaniline;methane.
| Compound Name | 2,4-difluoroaniline;methane |
|---|---|
| PubChem CID | 155026278 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2,4-difluoroaniline;methane |
| SMILES | C.Nc1ccc(F)cc1F |
| InChI | InChI=1S/C6H5F2N.CH4/c7-4-1-2-6(9)5(8)3-4;/h1-3H,9H2;1H4 |
| InChIKey | YYKLSTGOOJYVPR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|