C10H13F2NO2 — CID 174299671
2,4-difluoroaniline;propan-2-yl formate (PubChem CID 174299671) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2,4-difluoroaniline;propan-2-yl formate.
| Compound Name | 2,4-difluoroaniline;propan-2-yl formate |
|---|---|
| PubChem CID | 174299671 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2,4-difluoroaniline;propan-2-yl formate |
| SMILES | CC(C)OC=O.Nc1ccc(F)cc1F |
| InChI | InChI=1S/C6H5F2N.C4H8O2/c7-4-1-2-6(9)5(8)3-4;1-4(2)6-3-5/h1-3H,9H2;3-4H,1-2H3 |
| InChIKey | COGHGAVWQRTASP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|