C6H6F3N — CID 170944018
2,4-difluoroaniline;hydrofluoride (PubChem CID 170944018) has the molecular formula C6H6F3N and a molecular weight of 149.11 g/mol. Its IUPAC name is 2,4-difluoroaniline;hydrofluoride.
| Compound Name | 2,4-difluoroaniline;hydrofluoride |
|---|---|
| PubChem CID | 170944018 |
| Molecular Formula | C6H6F3N |
| Molecular Weight | 149.11 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 2,4-difluoroaniline;hydrofluoride |
| SMILES | F.Nc1ccc(F)cc1F |
| InChI | InChI=1S/C6H5F2N.FH/c7-4-1-2-6(9)5(8)3-4;/h1-3H,9H2;1H |
| InChIKey | TXYVUCQAJWEICK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.11 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|