C13H9F4N3 — CID 87852004
2,4-difluoroaniline;(2,4-difluorophenyl)cyanamide (PubChem CID 87852004) has the molecular formula C13H9F4N3 and a molecular weight of 283.23 g/mol. Its IUPAC name is 2,4-difluoroaniline;(2,4-difluorophenyl)cyanamide.
| Compound Name | 2,4-difluoroaniline;(2,4-difluorophenyl)cyanamide |
|---|---|
| PubChem CID | 87852004 |
| Molecular Formula | C13H9F4N3 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2,4-difluoroaniline;(2,4-difluorophenyl)cyanamide |
| SMILES | N#CNc1ccc(F)cc1F.Nc1ccc(F)cc1F |
| InChI | InChI=1S/C7H4F2N2.C6H5F2N/c8-5-1-2-7(11-4-10)6(9)3-5;7-4-1-2-6(9)5(8)3-4/h1-3,11H;1-3H,9H2 |
| InChIKey | GBYIZPGRHLYDDA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|