About 4-amino-3-fluorobenzonitrile;methane
4-amino-3-fluorobenzonitrile;methane (PubChem CID 174516091) has the molecular formula C8H9FN2
and a molecular weight of 152.17 g/mol. Its IUPAC name is 4-amino-3-fluorobenzonitrile;methane.
Molecular Properties
| Compound Name | 4-amino-3-fluorobenzonitrile;methane |
| PubChem CID | 174516091 |
| Molecular Formula | C8H9FN2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 4-amino-3-fluorobenzonitrile;methane |
| SMILES | C.N#Cc1ccc(N)c(F)c1 |
| InChI | InChI=1S/C7H5FN2.CH4/c8-6-3-5(4-9)1-2-7(6)10;/h1-3H,10H2;1H4 |
| InChIKey | VFZJYROISMFDFL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-fluorobenzonitrile;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-fluorobenzonitrile;methane?
The IUPAC name of 4-amino-3-fluorobenzonitrile;methane (CID 174516091) is 4-amino-3-fluorobenzonitrile;methane.
What is the SMILES notation for 4-amino-3-fluorobenzonitrile;methane?
The canonical SMILES for 4-amino-3-fluorobenzonitrile;methane is C.N#Cc1ccc(N)c(F)c1.
What is the InChIKey of 4-amino-3-fluorobenzonitrile;methane?
The InChIKey is VFZJYROISMFDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN2.CH4/c8-6-3-5(4-9)1-2-7(6)10;/h1-3H,10H2;1H4.
What are the key properties of 4-amino-3-fluorobenzonitrile;methane?
4-amino-3-fluorobenzonitrile;methane has a molecular weight of 152.17 g/mol, XLogP of 1.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-fluorobenzonitrile;methane is sourced from PubChem (CID 174516091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).