About (2-amino-5-cyanophenyl) hypofluorite
(2-amino-5-cyanophenyl) hypofluorite (PubChem CID 142393314) has the molecular formula C7H5FN2O
and a molecular weight of 152.13 g/mol. Its IUPAC name is (2-amino-5-cyanophenyl) hypofluorite.
Molecular Properties
| Compound Name | (2-amino-5-cyanophenyl) hypofluorite |
| PubChem CID | 142393314 |
| Molecular Formula | C7H5FN2O |
| Molecular Weight | 152.13 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | (2-amino-5-cyanophenyl) hypofluorite |
| SMILES | N#Cc1ccc(N)c(OF)c1 |
| InChI | InChI=1S/C7H5FN2O/c8-11-7-3-5(4-9)1-2-6(7)10/h1-3H,10H2 |
| InChIKey | RWBAREGWKPWVJB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.13 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-5-cyanophenyl) hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-5-cyanophenyl) hypofluorite?
The IUPAC name of (2-amino-5-cyanophenyl) hypofluorite (CID 142393314) is (2-amino-5-cyanophenyl) hypofluorite.
What is the SMILES notation for (2-amino-5-cyanophenyl) hypofluorite?
The canonical SMILES for (2-amino-5-cyanophenyl) hypofluorite is N#Cc1ccc(N)c(OF)c1.
What is the InChIKey of (2-amino-5-cyanophenyl) hypofluorite?
The InChIKey is RWBAREGWKPWVJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN2O/c8-11-7-3-5(4-9)1-2-6(7)10/h1-3H,10H2.
What are the key properties of (2-amino-5-cyanophenyl) hypofluorite?
(2-amino-5-cyanophenyl) hypofluorite has a molecular weight of 152.13 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-5-cyanophenyl) hypofluorite is sourced from PubChem (CID 142393314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).