C15H14N2O — CID 113444292
4-amino-3-(2,5-dimethylphenoxy)benzonitrile (PubChem CID 113444292) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-amino-3-(2,5-dimethylphenoxy)benzonitrile.
| Compound Name | 4-amino-3-(2,5-dimethylphenoxy)benzonitrile |
|---|---|
| PubChem CID | 113444292 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-amino-3-(2,5-dimethylphenoxy)benzonitrile |
| SMILES | Cc1ccc(C)c(Oc2cc(C#N)ccc2N)c1 |
| InChI | InChI=1S/C15H14N2O/c1-10-3-4-11(2)14(7-10)18-15-8-12(9-16)5-6-13(15)17/h3-8H,17H2,1-2H3 |
| InChIKey | HSFVQPFBEPZLPN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|