C16H16N2O — CID 43518303
3-amino-4-(2,3,5-trimethylphenoxy)benzonitrile (PubChem CID 43518303) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-amino-4-(2,3,5-trimethylphenoxy)benzonitrile.
| Compound Name | 3-amino-4-(2,3,5-trimethylphenoxy)benzonitrile |
|---|---|
| PubChem CID | 43518303 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-amino-4-(2,3,5-trimethylphenoxy)benzonitrile |
| SMILES | Cc1cc(C)c(C)c(Oc2ccc(C#N)cc2N)c1 |
| InChI | InChI=1S/C16H16N2O/c1-10-6-11(2)12(3)16(7-10)19-15-5-4-13(9-17)8-14(15)18/h4-8H,18H2,1-3H3 |
| InChIKey | BUFWSALKMLBZTP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|