C16H15N3O2 — CID 65455621
4-(2-amino-4-cyanophenoxy)-3,5-dimethylbenzamide (PubChem CID 65455621) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-(2-amino-4-cyanophenoxy)-3,5-dimethylbenzamide.
| Compound Name | 4-(2-amino-4-cyanophenoxy)-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 65455621 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-(2-amino-4-cyanophenoxy)-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C(N)=O)cc(C)c1Oc1ccc(C#N)cc1N |
| InChI | InChI=1S/C16H15N3O2/c1-9-5-12(16(19)20)6-10(2)15(9)21-14-4-3-11(8-17)7-13(14)18/h3-7H,18H2,1-2H3,(H2,19,20) |
| InChIKey | UXGUKGBPKMEOQA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|