C14H12N2O — CID 24698854
6-(2,5-dimethylphenoxy)pyridine-3-carbonitrile (PubChem CID 24698854) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 6-(2,5-dimethylphenoxy)pyridine-3-carbonitrile.
| Compound Name | 6-(2,5-dimethylphenoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 24698854 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 6-(2,5-dimethylphenoxy)pyridine-3-carbonitrile |
| SMILES | Cc1ccc(C)c(Oc2ccc(C#N)cn2)c1 |
| InChI | InChI=1S/C14H12N2O/c1-10-3-4-11(2)13(7-10)17-14-6-5-12(8-15)9-16-14/h3-7,9H,1-2H3 |
| InChIKey | LYKUFEPRFCFUHQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |