C13H10FN3O — CID 107670075
4-(3,4-diaminophenoxy)-3-fluorobenzonitrile (PubChem CID 107670075) has the molecular formula C13H10FN3O and a molecular weight of 243.24 g/mol. Its IUPAC name is 4-(3,4-diaminophenoxy)-3-fluorobenzonitrile.
| Compound Name | 4-(3,4-diaminophenoxy)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 107670075 |
| Molecular Formula | C13H10FN3O |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 4-(3,4-diaminophenoxy)-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(N)c(N)c2)c(F)c1 |
| InChI | InChI=1S/C13H10FN3O/c14-10-5-8(7-15)1-4-13(10)18-9-2-3-11(16)12(17)6-9/h1-6H,16-17H2 |
| InChIKey | MMWYWKUACAPTPP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|