C9H11FN2O6S — CID 175589874
acetic acid;4-amino-3-fluorobenzonitrile;sulfuric acid (PubChem CID 175589874) has the molecular formula C9H11FN2O6S and a molecular weight of 294.26 g/mol. Its IUPAC name is acetic acid;4-amino-3-fluorobenzonitrile;sulfuric acid.
| Compound Name | acetic acid;4-amino-3-fluorobenzonitrile;sulfuric acid |
|---|---|
| PubChem CID | 175589874 |
| Molecular Formula | C9H11FN2O6S |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | acetic acid;4-amino-3-fluorobenzonitrile;sulfuric acid |
| SMILES | CC(=O)O.N#Cc1ccc(N)c(F)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H5FN2.C2H4O2.H2O4S/c8-6-3-5(4-9)1-2-7(6)10;1-2(3)4;1-5(2,3)4/h1-3H,10H2;1H3,(H,3,4);(H2,1,2,3,4) |
| InChIKey | BFNNMQCMEOJAFC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 161.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|