C12H12FNO4S — CID 81228812
2-[(4-cyano-2-fluorophenyl)methylsulfonyl]-2-methylpropanoic acid (PubChem CID 81228812) has the molecular formula C12H12FNO4S and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[(4-cyano-2-fluorophenyl)methylsulfonyl]-2-methylpropanoic acid.
| Compound Name | 2-[(4-cyano-2-fluorophenyl)methylsulfonyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 81228812 |
| Molecular Formula | C12H12FNO4S |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-[(4-cyano-2-fluorophenyl)methylsulfonyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)S(=O)(=O)Cc1ccc(C#N)cc1F |
| InChI | InChI=1S/C12H12FNO4S/c1-12(2,11(15)16)19(17,18)7-9-4-3-8(6-14)5-10(9)13/h3-5H,7H2,1-2H3,(H,15,16) |
| InChIKey | XMBVODQNKPKPCI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |