About CID 90173962
CID 90173962 (PubChem CID 90173962) has the molecular formula C18H21F2O2Si
and a molecular weight of 335.45 g/mol.
Molecular Properties
| Compound Name | CID 90173962 |
| PubChem CID | 90173962 |
| Molecular Formula | C18H21F2O2Si |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | — |
| SMILES | CCCO[Si](OCCC)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H21F2O2Si/c1-3-11-21-23(22-12-4-2)16-8-5-14(6-9-16)17-10-7-15(19)13-18(17)20/h5-10,13H,3-4,11-12H2,1-2H3 |
| InChIKey | QPJOFQRMNFMLRB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90173962 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90173962?
The IUPAC name of CID 90173962 (CID 90173962) is not available.
What is the SMILES notation for CID 90173962?
The canonical SMILES for CID 90173962 is CCCO[Si](OCCC)c1ccc(-c2ccc(F)cc2F)cc1.
What is the InChIKey of CID 90173962?
The InChIKey is QPJOFQRMNFMLRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21F2O2Si/c1-3-11-21-23(22-12-4-2)16-8-5-14(6-9-16)17-10-7-15(19)13-18(17)20/h5-10,13H,3-4,11-12H2,1-2H3.
What are the key properties of CID 90173962?
CID 90173962 has a molecular weight of 335.45 g/mol, XLogP of 4.18, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90173962 is sourced from PubChem (CID 90173962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).