C11H8F10N+ — CID 23123182
1,1,2,2,2-pentafluoroethyl-(2,3,4,5,6-pentafluorophenyl)-propylazanium (PubChem CID 23123182) has the molecular formula C11H8F10N+ and a molecular weight of 344.17 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethyl-(2,3,4,5,6-pentafluorophenyl)-propylazanium.
| Compound Name | 1,1,2,2,2-pentafluoroethyl-(2,3,4,5,6-pentafluorophenyl)-propylazanium |
|---|---|
| PubChem CID | 23123182 |
| Molecular Formula | C11H8F10N+ |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethyl-(2,3,4,5,6-pentafluorophenyl)-propylazanium |
| SMILES | CCC[NH+](c1c(F)c(F)c(F)c(F)c1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F10N/c1-2-3-22(11(20,21)10(17,18)19)9-7(15)5(13)4(12)6(14)8(9)16/h2-3H2,1H3/p+1 |
| InChIKey | WIVODUNVGQKQLY-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|