C12H5F14P — CID 22637443
ethyl-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-(2,3,4,5,6-pentafluorophenyl)phosphane (PubChem CID 22637443) has the molecular formula C12H5F14P and a molecular weight of 446.12 g/mol. Its IUPAC name is ethyl-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-(2,3,4,5,6-pentafluorophenyl)phosphane.
| Compound Name | ethyl-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-(2,3,4,5,6-pentafluorophenyl)phosphane |
|---|---|
| PubChem CID | 22637443 |
| Molecular Formula | C12H5F14P |
| Molecular Weight | 446.12 g/mol |
| Exact Mass | 445.99 |
| IUPAC Name | ethyl-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-(2,3,4,5,6-pentafluorophenyl)phosphane |
| SMILES | CCP(c1c(F)c(F)c(F)c(F)c1F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H5F14P/c1-2-27(8-6(16)4(14)3(13)5(15)7(8)17)12(25,26)10(20,21)9(18,19)11(22,23)24/h2H2,1H3 |
| InChIKey | VWBULAPFYXUNCI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.12 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|