C11H12F5P — CID 22637866
butyl-methyl-(2,3,4,5,6-pentafluorophenyl)phosphane (PubChem CID 22637866) has the molecular formula C11H12F5P and a molecular weight of 270.18 g/mol. Its IUPAC name is butyl-methyl-(2,3,4,5,6-pentafluorophenyl)phosphane.
| Compound Name | butyl-methyl-(2,3,4,5,6-pentafluorophenyl)phosphane |
|---|---|
| PubChem CID | 22637866 |
| Molecular Formula | C11H12F5P |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | butyl-methyl-(2,3,4,5,6-pentafluorophenyl)phosphane |
| SMILES | CCCCP(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H12F5P/c1-3-4-5-17(2)11-9(15)7(13)6(12)8(14)10(11)16/h3-5H2,1-2H3 |
| InChIKey | LEWHZFAXVYCKIJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|