About gold;tributylphosphane
gold;tributylphosphane (PubChem CID 88800341) has the molecular formula C12H27AuP
and a molecular weight of 399.29 g/mol. Its IUPAC name is gold;tributylphosphane.
Molecular Properties
| Compound Name | gold;tributylphosphane |
| PubChem CID | 88800341 |
| Molecular Formula | C12H27AuP |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | gold;tributylphosphane |
| SMILES | CCCCP(CCCC)CCCC.[Au] |
| InChI | InChI=1S/C12H27P.Au/c1-4-7-10-13(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3; |
| InChIKey | QMQKUTDACMXYEJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze gold;tributylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;tributylphosphane?
The IUPAC name of gold;tributylphosphane (CID 88800341) is gold;tributylphosphane.
What is the SMILES notation for gold;tributylphosphane?
The canonical SMILES for gold;tributylphosphane is CCCCP(CCCC)CCCC.[Au].
What is the InChIKey of gold;tributylphosphane?
The InChIKey is QMQKUTDACMXYEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.Au/c1-4-7-10-13(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3;.
What are the key properties of gold;tributylphosphane?
gold;tributylphosphane has a molecular weight of 399.29 g/mol, XLogP of 4.87, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for gold;tributylphosphane is sourced from PubChem (CID 88800341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).