About cobalt;rhodium;tributylphosphane
cobalt;rhodium;tributylphosphane (PubChem CID 174653599) has the molecular formula C12H27CoPRh
and a molecular weight of 364.16 g/mol. Its IUPAC name is cobalt;rhodium;tributylphosphane.
Molecular Properties
| Compound Name | cobalt;rhodium;tributylphosphane |
| PubChem CID | 174653599 |
| Molecular Formula | C12H27CoPRh |
| Molecular Weight | 364.16 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | cobalt;rhodium;tributylphosphane |
| SMILES | CCCCP(CCCC)CCCC.[Co].[Rh] |
| InChI | InChI=1S/C12H27P.Co.Rh/c1-4-7-10-13(11-8-5-2)12-9-6-3;;/h4-12H2,1-3H3;; |
| InChIKey | SAYPDEPWOLEFCA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.16 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cobalt;rhodium;tributylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;rhodium;tributylphosphane?
The IUPAC name of cobalt;rhodium;tributylphosphane (CID 174653599) is cobalt;rhodium;tributylphosphane.
What is the SMILES notation for cobalt;rhodium;tributylphosphane?
The canonical SMILES for cobalt;rhodium;tributylphosphane is CCCCP(CCCC)CCCC.[Co].[Rh].
What is the InChIKey of cobalt;rhodium;tributylphosphane?
The InChIKey is SAYPDEPWOLEFCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.Co.Rh/c1-4-7-10-13(11-8-5-2)12-9-6-3;;/h4-12H2,1-3H3;;.
What are the key properties of cobalt;rhodium;tributylphosphane?
cobalt;rhodium;tributylphosphane has a molecular weight of 364.16 g/mol, XLogP of 4.86, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;rhodium;tributylphosphane is sourced from PubChem (CID 174653599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).