About nickel;bis(tributylphosphane)
nickel;bis(tributylphosphane) (PubChem CID 50940317) has the molecular formula C24H54NiP2
and a molecular weight of 463.34 g/mol. Its IUPAC name is nickel;bis(tributylphosphane).
Molecular Properties
| Compound Name | nickel;bis(tributylphosphane) |
| PubChem CID | 50940317 |
| Molecular Formula | C24H54NiP2 |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | nickel;bis(tributylphosphane) |
| SMILES | CCCCP(CCCC)CCCC.CCCCP(CCCC)CCCC.[Ni] |
| InChI | InChI=1S/2C12H27P.Ni/c2*1-4-7-10-13(11-8-5-2)12-9-6-3;/h2*4-12H2,1-3H3; |
| InChIKey | PPFQMADUQXIJLH-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze nickel;bis(tributylphosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;bis(tributylphosphane)?
The IUPAC name of nickel;bis(tributylphosphane) (CID 50940317) is nickel;bis(tributylphosphane).
What is the SMILES notation for nickel;bis(tributylphosphane)?
The canonical SMILES for nickel;bis(tributylphosphane) is CCCCP(CCCC)CCCC.CCCCP(CCCC)CCCC.[Ni].
What is the InChIKey of nickel;bis(tributylphosphane)?
The InChIKey is PPFQMADUQXIJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H27P.Ni/c2*1-4-7-10-13(11-8-5-2)12-9-6-3;/h2*4-12H2,1-3H3;.
What are the key properties of nickel;bis(tributylphosphane)?
nickel;bis(tributylphosphane) has a molecular weight of 463.34 g/mol, XLogP of 9.73, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;bis(tributylphosphane) is sourced from PubChem (CID 50940317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).