About tripentylphosphane
tripentylphosphane (PubChem CID 2784073) has the molecular formula C15H33P
and a molecular weight of 244.40 g/mol. Its IUPAC name is tripentylphosphane.
Molecular Properties
| Compound Name | tripentylphosphane |
| PubChem CID | 2784073 |
| Molecular Formula | C15H33P |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | tripentylphosphane |
| SMILES | CCCCCP(CCCCC)CCCCC |
| InChI | InChI=1S/C15H33P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-15H2,1-3H3 |
| InChIKey | IWPNEBZUNGZQQQ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tripentylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripentylphosphane?
The IUPAC name of tripentylphosphane (CID 2784073) is tripentylphosphane.
What is the SMILES notation for tripentylphosphane?
The canonical SMILES for tripentylphosphane is CCCCCP(CCCCC)CCCCC.
What is the InChIKey of tripentylphosphane?
The InChIKey is IWPNEBZUNGZQQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-15H2,1-3H3.
What are the key properties of tripentylphosphane?
tripentylphosphane has a molecular weight of 244.40 g/mol, XLogP of 6.04, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tripentylphosphane is sourced from PubChem (CID 2784073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).