About bismuthane;trioctylphosphane
bismuthane;trioctylphosphane (PubChem CID 174398286) has the molecular formula C24H54BiP
and a molecular weight of 582.65 g/mol. Its IUPAC name is bismuthane;trioctylphosphane.
Molecular Properties
| Compound Name | bismuthane;trioctylphosphane |
| PubChem CID | 174398286 |
| Molecular Formula | C24H54BiP |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | bismuthane;trioctylphosphane |
| SMILES | CCCCCCCCP(CCCCCCCC)CCCCCCCC.[BiH3] |
| InChI | InChI=1S/C24H51P.Bi.3H/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;;;;/h4-24H2,1-3H3;;;; |
| InChIKey | FKQJAXFBMJZRNL-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bismuthane;trioctylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bismuthane;trioctylphosphane?
The IUPAC name of bismuthane;trioctylphosphane (CID 174398286) is bismuthane;trioctylphosphane.
What is the SMILES notation for bismuthane;trioctylphosphane?
The canonical SMILES for bismuthane;trioctylphosphane is CCCCCCCCP(CCCCCCCC)CCCCCCCC.[BiH3].
What is the InChIKey of bismuthane;trioctylphosphane?
The InChIKey is FKQJAXFBMJZRNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51P.Bi.3H/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;;;;/h4-24H2,1-3H3;;;;.
What are the key properties of bismuthane;trioctylphosphane?
bismuthane;trioctylphosphane has a molecular weight of 582.65 g/mol, XLogP of 8.37, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bismuthane;trioctylphosphane is sourced from PubChem (CID 174398286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).