About bromomethane;trioctylphosphane
bromomethane;trioctylphosphane (PubChem CID 175266178) has the molecular formula C25H54BrP
and a molecular weight of 465.59 g/mol. Its IUPAC name is bromomethane;trioctylphosphane.
Molecular Properties
| Compound Name | bromomethane;trioctylphosphane |
| PubChem CID | 175266178 |
| Molecular Formula | C25H54BrP |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | bromomethane;trioctylphosphane |
| SMILES | CBr.CCCCCCCCP(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C24H51P.CH3Br/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2/h4-24H2,1-3H3;1H3 |
| InChIKey | DTZFATOMCVCPTB-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bromomethane;trioctylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethane;trioctylphosphane?
The IUPAC name of bromomethane;trioctylphosphane (CID 175266178) is bromomethane;trioctylphosphane.
What is the SMILES notation for bromomethane;trioctylphosphane?
The canonical SMILES for bromomethane;trioctylphosphane is CBr.CCCCCCCCP(CCCCCCCC)CCCCCCCC.
What is the InChIKey of bromomethane;trioctylphosphane?
The InChIKey is DTZFATOMCVCPTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51P.CH3Br/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2/h4-24H2,1-3H3;1H3.
What are the key properties of bromomethane;trioctylphosphane?
bromomethane;trioctylphosphane has a molecular weight of 465.59 g/mol, XLogP of 10.56, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethane;trioctylphosphane is sourced from PubChem (CID 175266178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).