About dibutyl(decyl)phosphane
dibutyl(decyl)phosphane (PubChem CID 171559269) has the molecular formula C18H39P
and a molecular weight of 286.48 g/mol. Its IUPAC name is dibutyl(decyl)phosphane.
Molecular Properties
| Compound Name | dibutyl(decyl)phosphane |
| PubChem CID | 171559269 |
| Molecular Formula | C18H39P |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.28 |
| IUPAC Name | dibutyl(decyl)phosphane |
| SMILES | CCCCCCCCCCP(CCCC)CCCC |
| InChI | InChI=1S/C18H39P/c1-4-7-10-11-12-13-14-15-18-19(16-8-5-2)17-9-6-3/h4-18H2,1-3H3 |
| InChIKey | IBNDFLJCWOOZMT-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibutyl(decyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl(decyl)phosphane?
The IUPAC name of dibutyl(decyl)phosphane (CID 171559269) is dibutyl(decyl)phosphane.
What is the SMILES notation for dibutyl(decyl)phosphane?
The canonical SMILES for dibutyl(decyl)phosphane is CCCCCCCCCCP(CCCC)CCCC.
What is the InChIKey of dibutyl(decyl)phosphane?
The InChIKey is IBNDFLJCWOOZMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39P/c1-4-7-10-11-12-13-14-15-18-19(16-8-5-2)17-9-6-3/h4-18H2,1-3H3.
What are the key properties of dibutyl(decyl)phosphane?
dibutyl(decyl)phosphane has a molecular weight of 286.48 g/mol, XLogP of 7.21, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl(decyl)phosphane is sourced from PubChem (CID 171559269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).