About azane;trioctylphosphane;hydrobromide
azane;trioctylphosphane;hydrobromide (PubChem CID 174675093) has the molecular formula C24H55BrNP
and a molecular weight of 468.59 g/mol. Its IUPAC name is azane;trioctylphosphane;hydrobromide.
Molecular Properties
| Compound Name | azane;trioctylphosphane;hydrobromide |
| PubChem CID | 174675093 |
| Molecular Formula | C24H55BrNP |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 467.33 |
| IUPAC Name | azane;trioctylphosphane;hydrobromide |
| SMILES | Br.CCCCCCCCP(CCCCCCCC)CCCCCCCC.N |
| InChI | InChI=1S/C24H51P.BrH.H3N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;;/h4-24H2,1-3H3;1H;1H3 |
| InChIKey | MYRBWKYLIALVDH-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;trioctylphosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;trioctylphosphane;hydrobromide?
The IUPAC name of azane;trioctylphosphane;hydrobromide (CID 174675093) is azane;trioctylphosphane;hydrobromide.
What is the SMILES notation for azane;trioctylphosphane;hydrobromide?
The canonical SMILES for azane;trioctylphosphane;hydrobromide is Br.CCCCCCCCP(CCCCCCCC)CCCCCCCC.N.
What is the InChIKey of azane;trioctylphosphane;hydrobromide?
The InChIKey is MYRBWKYLIALVDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51P.BrH.H3N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;;/h4-24H2,1-3H3;1H;1H3.
What are the key properties of azane;trioctylphosphane;hydrobromide?
azane;trioctylphosphane;hydrobromide has a molecular weight of 468.59 g/mol, XLogP of 10.29, 21 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;trioctylphosphane;hydrobromide is sourced from PubChem (CID 174675093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).