About tributylphosphane;trichlorocobalt
tributylphosphane;trichlorocobalt (PubChem CID 174913282) has the molecular formula C12H27Cl3CoP
and a molecular weight of 367.61 g/mol. Its IUPAC name is tributylphosphane;trichlorocobalt.
Molecular Properties
| Compound Name | tributylphosphane;trichlorocobalt |
| PubChem CID | 174913282 |
| Molecular Formula | C12H27Cl3CoP |
| Molecular Weight | 367.61 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | tributylphosphane;trichlorocobalt |
| SMILES | CCCCP(CCCC)CCCC.Cl[Co](Cl)Cl |
| InChI | InChI=1S/C12H27P.3ClH.Co/c1-4-7-10-13(11-8-5-2)12-9-6-3;;;;/h4-12H2,1-3H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | GJCNSHPKIYXVRO-UHFFFAOYSA-K |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tributylphosphane;trichlorocobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributylphosphane;trichlorocobalt?
The IUPAC name of tributylphosphane;trichlorocobalt (CID 174913282) is tributylphosphane;trichlorocobalt.
What is the SMILES notation for tributylphosphane;trichlorocobalt?
The canonical SMILES for tributylphosphane;trichlorocobalt is CCCCP(CCCC)CCCC.Cl[Co](Cl)Cl.
What is the InChIKey of tributylphosphane;trichlorocobalt?
The InChIKey is GJCNSHPKIYXVRO-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H27P.3ClH.Co/c1-4-7-10-13(11-8-5-2)12-9-6-3;;;;/h4-12H2,1-3H3;3*1H;/q;;;;+3/p-3.
What are the key properties of tributylphosphane;trichlorocobalt?
tributylphosphane;trichlorocobalt has a molecular weight of 367.61 g/mol, XLogP of 6.93, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributylphosphane;trichlorocobalt is sourced from PubChem (CID 174913282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).