About chloroform;tributylphosphane
chloroform;tributylphosphane (PubChem CID 87403775) has the molecular formula C13H28Cl3P
and a molecular weight of 321.70 g/mol. Its IUPAC name is chloroform;tributylphosphane.
Molecular Properties
| Compound Name | chloroform;tributylphosphane |
| PubChem CID | 87403775 |
| Molecular Formula | C13H28Cl3P |
| Molecular Weight | 321.70 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | chloroform;tributylphosphane |
| SMILES | CCCCP(CCCC)CCCC.ClC(Cl)Cl |
| InChI | InChI=1S/C12H27P.CHCl3/c1-4-7-10-13(11-8-5-2)12-9-6-3;2-1(3)4/h4-12H2,1-3H3;1H |
| InChIKey | REUKIDGHTMSUJF-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.70 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloroform;tributylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;tributylphosphane?
The IUPAC name of chloroform;tributylphosphane (CID 87403775) is chloroform;tributylphosphane.
What is the SMILES notation for chloroform;tributylphosphane?
The canonical SMILES for chloroform;tributylphosphane is CCCCP(CCCC)CCCC.ClC(Cl)Cl.
What is the InChIKey of chloroform;tributylphosphane?
The InChIKey is REUKIDGHTMSUJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.CHCl3/c1-4-7-10-13(11-8-5-2)12-9-6-3;2-1(3)4/h4-12H2,1-3H3;1H.
What are the key properties of chloroform;tributylphosphane?
chloroform;tributylphosphane has a molecular weight of 321.70 g/mol, XLogP of 6.86, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;tributylphosphane is sourced from PubChem (CID 87403775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).