About azane;tributylphosphane
azane;tributylphosphane (PubChem CID 87538509) has the molecular formula C12H30NP
and a molecular weight of 219.35 g/mol. Its IUPAC name is azane;tributylphosphane.
Molecular Properties
| Compound Name | azane;tributylphosphane |
| PubChem CID | 87538509 |
| Molecular Formula | C12H30NP |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.21 |
| IUPAC Name | azane;tributylphosphane |
| SMILES | CCCCP(CCCC)CCCC.N |
| InChI | InChI=1S/C12H27P.H3N/c1-4-7-10-13(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3;1H3 |
| InChIKey | YJJQUZUMFKEFET-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;tributylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;tributylphosphane?
The IUPAC name of azane;tributylphosphane (CID 87538509) is azane;tributylphosphane.
What is the SMILES notation for azane;tributylphosphane?
The canonical SMILES for azane;tributylphosphane is CCCCP(CCCC)CCCC.N.
What is the InChIKey of azane;tributylphosphane?
The InChIKey is YJJQUZUMFKEFET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.H3N/c1-4-7-10-13(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3;1H3.
What are the key properties of azane;tributylphosphane?
azane;tributylphosphane has a molecular weight of 219.35 g/mol, XLogP of 5.03, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;tributylphosphane is sourced from PubChem (CID 87538509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).