C28H12AlF20N — CID 87556247
butylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)alumanuide (PubChem CID 87556247) has the molecular formula C28H12AlF20N and a molecular weight of 769.35 g/mol. Its IUPAC name is butylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)alumanuide.
| Compound Name | butylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)alumanuide |
|---|---|
| PubChem CID | 87556247 |
| Molecular Formula | C28H12AlF20N |
| Molecular Weight | 769.35 g/mol |
| Exact Mass | 769.05 |
| IUPAC Name | butylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)alumanuide |
| SMILES | CCCC[NH3+].Fc1c(F)c(F)c([Al-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/4C6F5.C4H11N.Al/c4*7-2-1-3(8)5(10)6(11)4(2)9;1-2-3-4-5;/h;;;;2-5H2,1H3;/q;;;;;-1/p+1 |
| InChIKey | MLKVQPGEIBVRDW-UHFFFAOYSA-O |
| XLogP | 5.87 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|