About butylazanium;oxalate
butylazanium;oxalate (PubChem CID 19844195) has the molecular formula C10H24N2O4
and a molecular weight of 236.31 g/mol. Its IUPAC name is butylazanium;oxalate.
Molecular Properties
| Compound Name | butylazanium;oxalate |
| PubChem CID | 19844195 |
| Molecular Formula | C10H24N2O4 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | butylazanium;oxalate |
| SMILES | CCCC[NH3+].CCCC[NH3+].O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C4H11N.C2H2O4/c2*1-2-3-4-5;3-1(4)2(5)6/h2*2-5H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | KICZOBJDLGFYNR-UHFFFAOYSA-N |
| XLogP | -3.46 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze butylazanium;oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylazanium;oxalate?
The IUPAC name of butylazanium;oxalate (CID 19844195) is butylazanium;oxalate.
What is the SMILES notation for butylazanium;oxalate?
The canonical SMILES for butylazanium;oxalate is CCCC[NH3+].CCCC[NH3+].O=C([O-])C(=O)[O-].
What is the InChIKey of butylazanium;oxalate?
The InChIKey is KICZOBJDLGFYNR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H11N.C2H2O4/c2*1-2-3-4-5;3-1(4)2(5)6/h2*2-5H2,1H3;(H,3,4)(H,5,6).
What are the key properties of butylazanium;oxalate?
butylazanium;oxalate has a molecular weight of 236.31 g/mol, XLogP of -3.46, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butylazanium;oxalate is sourced from PubChem (CID 19844195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).